CAS 96757-76-5 is the registry number for 1-(4-Fluorophenyl)-2,6,6-trimethyl-5,6,7-trihydroindol-4-one. Offered by: Biosynth. Available pack sizes: 500mg, 250mg, 1000mg, 2000mg, 5000mg.
1-(4-fluorophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one (CAS 96757-76-5) is a chemical compound with the molecular formula C17H18FNO and a molecular weight of 271.33 g/mol. IUPAC name: 1-(4-fluorophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one. InChIKey: NRHCPYKCFHECID-UHFFFAOYSA-N.
| Molecular formula | C17H18FNO |
|---|---|
| Molecular weight | 271.33 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-2,6,6-trimethyl-5,7-dihydroindol-4-one |
| InChIKey | NRHCPYKCFHECID-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(N1C3=CC=C(C=C3)F)CC(CC2=O)(C)C |
Computed by PubChem (NCBI)