CAS 634155-04-7 is the registry number for 2-(1-imino-2,2-dimethylpropyl)indane-1,3-dione. Offered by: Biosynth. Available pack sizes: 250mg.
2-(2,2-dimethylpropanimidoyl)indene-1,3-dione (CAS 634155-04-7) is a chemical compound with the molecular formula C14H15NO2 and a molecular weight of 229.27 g/mol. IUPAC name: 2-(2,2-dimethylpropanimidoyl)indene-1,3-dione. InChIKey: UEXLANGUMDSWMK-UHFFFAOYSA-N.
| Molecular formula | C14H15NO2 |
|---|---|
| Molecular weight | 229.27 g/mol |
| IUPAC name | 2-(2,2-dimethylpropanimidoyl)indene-1,3-dione |
| InChIKey | UEXLANGUMDSWMK-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=N)C1C(=O)C2=CC=CC=C2C1=O |
Computed by PubChem (NCBI)