Products 634180-49-7
CAS 634180-49-7 appears in our catalog under these names: (1R,1'R)-1,1',2,2',3,3',4,4'-octahydro-1,1'-biisoquinoline, 97% 99%ee, 97% 99%ee, (1R,1'R)-1,1',2,2',3,3',4,4'-OCTAHYDRO-1,1'-BIISOQUINOLINE, 97% 99%ee. Offered by: Chemat, Fluorochem, Ambeed. Available pack sizes: 50mg, 100mg, 1g, 250mg.
(1R)-1-[(1R)-1,2,3,4-tetrahydroisoquinolin-1-yl]-1,2,3,4-tetrahydroisoquinoline (CAS 634180-49-7) is a chemical compound with the molecular formula C18H20N2 and a molecular weight of 264.4 g/mol. IUPAC name: (1R)-1-[(1R)-1,2,3,4-tetrahydroisoquinolin-1-yl]-1,2,3,4-tetrahydroisoquinoline. InChIKey: NDHNLLQPMVDMRO-QZTJIDSGSA-N.
| Molecular formula | C18H20N2 |
|---|---|
| Molecular weight | 264.4 g/mol |
| IUPAC name | (1R)-1-[(1R)-1,2,3,4-tetrahydroisoquinolin-1-yl]-1,2,3,4-tetrahydroisoquinoline |
| InChIKey | NDHNLLQPMVDMRO-QZTJIDSGSA-N |
| SMILES | C1CN[C@H](C2=CC=CC=C21)[C@H]3C4=CC=CC=C4CCN3 |
Computed by PubChem (NCBI)