CAS 62642-62-0 appears in our catalog under these names: 4-(Morpholinomethyl)benzoic acid, 97%, 4-(Morpholinomethyl)benzoic Acid, 4–(Morpholinomethyl)benzoic acid, 4-(Morpholinomethyl)benzoic acid, 97% , 4-(Morpholinomethyl)benzoic acid, 98%, 98%. Offered by: Combi-blocks, TRC, GLPBio, Thermo Scientific, Chemat. Available pack sizes: 10g, 100g, 5g, 25g, 1g, 250MG.
4-(morpholin-4-ylmethyl)benzoic acid (CAS 62642-62-0) is a chemical compound with the molecular formula C12H15NO3 and a molecular weight of 221.25 g/mol. IUPAC name: 4-(morpholin-4-ylmethyl)benzoic acid. InChIKey: QYBXZYYECZFQRX-UHFFFAOYSA-N.
| Molecular formula | C12H15NO3 |
|---|---|
| Molecular weight | 221.25 g/mol |
| IUPAC name | 4-(morpholin-4-ylmethyl)benzoic acid |
| InChIKey | QYBXZYYECZFQRX-UHFFFAOYSA-N |
| SMILES | C1COCCN1CC2=CC=C(C=C2)C(=O)O |
Computed by PubChem (NCBI)