CAS 63469-82-9 is the registry number for 2,7-Dibromoanthracene, 97%. Offered by: AmBeed. Available pack sizes: 1g.
2,7-dibromoanthracene (CAS 63469-82-9) is a chemical compound with the molecular formula C14H8Br2 and a molecular weight of 336.02 g/mol. IUPAC name: 2,7-dibromoanthracene. InChIKey: DWRLOOFPLSQJEC-UHFFFAOYSA-N.
| Molecular formula | C14H8Br2 |
|---|---|
| Molecular weight | 336.02 g/mol |
| IUPAC name | 2,7-dibromoanthracene |
| InChIKey | DWRLOOFPLSQJEC-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC2=CC3=C(C=CC(=C3)Br)C=C21)Br |
Computed by PubChem (NCBI)