CAS 63485-73-4 is the registry number for 3–Methylisoquinolin–7–ol. Offered by: GLPBio. Available pack sizes: 100mg, 1g, 250mg.
3-methylisoquinolin-7-ol (CAS 63485-73-4) is a chemical compound with the molecular formula C10H9NO and a molecular weight of 159.18 g/mol. IUPAC name: 3-methylisoquinolin-7-ol. InChIKey: UWFGJQKHZPXWKV-UHFFFAOYSA-N.
| Molecular formula | C10H9NO |
|---|---|
| Molecular weight | 159.18 g/mol |
| IUPAC name | 3-methylisoquinolin-7-ol |
| InChIKey | UWFGJQKHZPXWKV-UHFFFAOYSA-N |
| SMILES | CC1=CC2=C(C=C(C=C2)O)C=N1 |
Computed by PubChem (NCBI)