CAS 1005-24-9 appears in our catalog under these names: 3-Carbamyl-1-methylpyridinium chloride, 98%, 1-Methylnicotinamide Chloride, >95% (HPLC), 1-Methylnicotinamide chloride, TRIA-662/ 100%, 1–Methylnicotinamide (chloride). Offered by: Combi-blocks, TRC, Dr. Ehrenstorfer, TargetMol, GLPBio. Available pack sizes: 25g, 1g, 5g, 100mg, 50mg, 250mg, 200mg, 500mg.
1-methylpyridin-1-ium-3-carboxamide chloride (CAS 1005-24-9) is a chemical compound with the molecular formula C7H9ClN2O and a molecular weight of 172.61 g/mol. IUPAC name: 1-methylpyridin-1-ium-3-carboxamide chloride. InChIKey: BWVDQVQUNNBTLK-UHFFFAOYSA-N.
| Molecular formula | C7H9ClN2O |
|---|---|
| Molecular weight | 172.61 g/mol |
| IUPAC name | 1-methylpyridin-1-ium-3-carboxamide chloride |
| InChIKey | BWVDQVQUNNBTLK-UHFFFAOYSA-N |
| SMILES | C[N+]1=CC=CC(=C1)C(=O)N.[Cl-] |
Computed by PubChem (NCBI)