Products 635299-75-1
CAS 635299-75-1 is the registry number for (3R,5R)-5-(Aminomethyl)-1-benzylpyrrolidin-3-ol. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
(3R,5R)-5-(aminomethyl)-1-benzylpyrrolidin-3-ol (CAS 635299-75-1) is a chemical compound with the molecular formula C12H18N2O and a molecular weight of 206.28 g/mol. IUPAC name: (3R,5R)-5-(aminomethyl)-1-benzylpyrrolidin-3-ol. InChIKey: OJLWRBSJLOKJNJ-VXGBXAGGSA-N.
| Molecular formula | C12H18N2O |
|---|---|
| Molecular weight | 206.28 g/mol |
| IUPAC name | (3R,5R)-5-(aminomethyl)-1-benzylpyrrolidin-3-ol |
| InChIKey | OJLWRBSJLOKJNJ-VXGBXAGGSA-N |
| SMILES | C1[C@H](CN([C@H]1CN)CC2=CC=CC=C2)O |
Computed by PubChem (NCBI)