CAS 635317-47-4 appears in our catalog under these names: Methyl 2,3–diamino–6–chlorobenzoate, Methyl 2,3-diamino-6-chlorobenzoate 95+%, Methyl 2,3-diamino-6-chlorobenzoate, 95+%, 95+%, METHYL 2,3-DIAMINO-6-CHLOROBENZOATE, 95+%. Offered by: GLPBio, Ambeed, Chemat, Fluorochem. Available pack sizes: 50mg, 5g, 100mg, 250mg, 1g.
Methyl 2,3-diamino-6-chlorobenzoate (CAS 635317-47-4) is a chemical compound with the molecular formula C8H9ClN2O2 and a molecular weight of 200.62 g/mol. IUPAC name: methyl 2,3-diamino-6-chlorobenzoate. InChIKey: GYJRCSNNRVQWHT-UHFFFAOYSA-N.
| Molecular formula | C8H9ClN2O2 |
|---|---|
| Molecular weight | 200.62 g/mol |
| IUPAC name | methyl 2,3-diamino-6-chlorobenzoate |
| InChIKey | GYJRCSNNRVQWHT-UHFFFAOYSA-N |
| SMILES | COC(=O)C1=C(C=CC(=C1N)N)Cl |
Computed by PubChem (NCBI)