CAS 6367-14-2 appears in our catalog under these names: Ac-Tyr-NHMe, 98%, Ac–Tyr–NHMe, AC-TYR-NHME, 97%, 97%, Acetyl-L-tyrosine methyl amide, 97%. Offered by: Combi-blocks, GLPBio, Chemat, Fluorochem. Available pack sizes: 5g, 250mg, 1g, 100mg.
(2S)-2-acetamido-3-(4-hydroxyphenyl)-N-methylpropanamide (CAS 6367-14-2) is a chemical compound with the molecular formula C12H16N2O3 and a molecular weight of 236.27 g/mol. IUPAC name: (2S)-2-acetamido-3-(4-hydroxyphenyl)-N-methylpropanamide. InChIKey: KHRMBHFDICMQHO-NSHDSACASA-N.
| Molecular formula | C12H16N2O3 |
|---|---|
| Molecular weight | 236.27 g/mol |
| IUPAC name | (2S)-2-acetamido-3-(4-hydroxyphenyl)-N-methylpropanamide |
| InChIKey | KHRMBHFDICMQHO-NSHDSACASA-N |
| SMILES | CC(=O)N[C@@H](CC1=CC=C(C=C1)O)C(=O)NC |
Computed by PubChem (NCBI)