Products 63737-97-3
CAS 63737-97-3 is the registry number for (Z)-4-((7-(Dimethylamino)-4-methyl-2-oxo-2H-1-benzopyran-3-yl)amino)-4-oxo-2-butenoic Acid. Offered by: TRC. Available pack sizes: 100mg.
4-[[7-(dimethylamino)-4-methyl-2-oxochromen-3-yl]amino]-4-oxobut-2-enoic acid (CAS 63737-97-3) is a chemical compound with the molecular formula C16H16N2O5 and a molecular weight of 316.31 g/mol. IUPAC name: 4-[[7-(dimethylamino)-4-methyl-2-oxochromen-3-yl]amino]-4-oxobut-2-enoic acid. InChIKey: PYLJIPPAQOEZEY-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O5 |
|---|---|
| Molecular weight | 316.31 g/mol |
| IUPAC name | 4-[[7-(dimethylamino)-4-methyl-2-oxochromen-3-yl]amino]-4-oxobut-2-enoic acid |
| InChIKey | PYLJIPPAQOEZEY-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=O)OC2=C1C=CC(=C2)N(C)C)NC(=O)C=CC(=O)O |
Computed by PubChem (NCBI)