Products 161954-97-8

CAS 161954-97-8 is the registry number for 4-(2-(2-(Naphthalen-2-yloxy)acetyl)hydrazinyl)-4-oxobutanoic acid, 98%. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

4-[2-(2-naphthalen-2-yloxyacetyl)hydrazinyl]-4-oxobutanoic acid (CAS 161954-97-8) is a chemical compound with the molecular formula C16H16N2O5 and a molecular weight of 316.31 g/mol. IUPAC name: 4-[2-(2-naphthalen-2-yloxyacetyl)hydrazinyl]-4-oxobutanoic acid. InChIKey: FVLZBLAFXLHSQA-UHFFFAOYSA-N.

Identity
Molecular formulaC16H16N2O5
Molecular weight316.31 g/mol
IUPAC name4-[2-(2-naphthalen-2-yloxyacetyl)hydrazinyl]-4-oxobutanoic acid
InChIKeyFVLZBLAFXLHSQA-UHFFFAOYSA-N
SMILESC1=CC=C2C=C(C=CC2=C1)OCC(=O)NNC(=O)CCC(=O)O

Computed by PubChem (NCBI)