CAS 120275-48-1 is the registry number for N-((3,4-dimethoxyphenyl)methyl)(2-nitrophenyl)formamide. Offered by: Biosynth. Available pack sizes: 5000mg.
N-[(3,4-dimethoxyphenyl)methyl]-2-nitrobenzamide (CAS 120275-48-1) is a chemical compound with the molecular formula C16H16N2O5 and a molecular weight of 316.31 g/mol. IUPAC name: N-[(3,4-dimethoxyphenyl)methyl]-2-nitrobenzamide. InChIKey: RDEJEIGCUKHTTK-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O5 |
|---|---|
| Molecular weight | 316.31 g/mol |
| IUPAC name | N-[(3,4-dimethoxyphenyl)methyl]-2-nitrobenzamide |
| InChIKey | RDEJEIGCUKHTTK-UHFFFAOYSA-N |
| SMILES | COC1=C(C=C(C=C1)CNC(=O)C2=CC=CC=C2[N+](=O)[O-])OC |
Computed by PubChem (NCBI)