CAS 2703770-71-0 appears in our catalog under these names: 3-(2-(2,6-Dioxopiperidin-3-yl)-3-oxoisoindolin-5-yl)propanoic acid 95%, Desamino lenalidomide-C2-COOH, 98.29%. Offered by: Ambeed, MedChemExpress. Available pack sizes: 50mg, 100mg, 250mg, 1g, 50 mg, 100 mg, 25 mg.
3-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]propanoic acid (CAS 2703770-71-0) is a chemical compound with the molecular formula C16H16N2O5 and a molecular weight of 316.31 g/mol. IUPAC name: 3-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]propanoic acid. InChIKey: ZKDYUEBTKRQDQH-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O5 |
|---|---|
| Molecular weight | 316.31 g/mol |
| IUPAC name | 3-[2-(2,6-dioxopiperidin-3-yl)-3-oxo-1H-isoindol-5-yl]propanoic acid |
| InChIKey | ZKDYUEBTKRQDQH-UHFFFAOYSA-N |
| SMILES | C1CC(=O)NC(=O)C1N2CC3=C(C2=O)C=C(C=C3)CCC(=O)O |
Computed by PubChem (NCBI)