Products 63805-77-6
CAS 63805-77-6 is the registry number for 4-[(1-Isocyanocyclopropyl)sulfonyl]toluene, >97%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
1-(1-isocyanocyclopropyl)sulfonyl-4-methylbenzene (CAS 63805-77-6) is a chemical compound with the molecular formula C11H11NO2S and a molecular weight of 221.28 g/mol. IUPAC name: 1-(1-isocyanocyclopropyl)sulfonyl-4-methylbenzene. InChIKey: BOMIJCVZAIXUQB-UHFFFAOYSA-N.
| Molecular formula | C11H11NO2S |
|---|---|
| Molecular weight | 221.28 g/mol |
| IUPAC name | 1-(1-isocyanocyclopropyl)sulfonyl-4-methylbenzene |
| InChIKey | BOMIJCVZAIXUQB-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)C2(CC2)[N+]#[C-] |
Computed by PubChem (NCBI)