CAS 639519-99-6 is the registry number for N-(2,2,2-Trifluoroethyl)thiophene-2-carboxamide, 95%. Offered by: Chemat Brand. Available pack sizes: on request.
N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide (CAS 639519-99-6) is a chemical compound with the molecular formula C7H6F3NOS and a molecular weight of 209.19 g/mol. IUPAC name: N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide. InChIKey: OEKSZICJVPCAAY-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NOS |
|---|---|
| Molecular weight | 209.19 g/mol |
| IUPAC name | N-(2,2,2-trifluoroethyl)thiophene-2-carboxamide |
| InChIKey | OEKSZICJVPCAAY-UHFFFAOYSA-N |
| SMILES | C1=CSC(=C1)C(=O)NCC(F)(F)F |
Computed by PubChem (NCBI)