CAS 708-67-8 is the registry number for 4-((Trifluoromethyl)sulfinyl)aniline. Offered by: Biosynth. Available pack sizes: 1g, 100mg.
4-(trifluoromethylsulfinyl)aniline (CAS 708-67-8) is a chemical compound with the molecular formula C7H6F3NOS and a molecular weight of 209.19 g/mol. IUPAC name: 4-(trifluoromethylsulfinyl)aniline. InChIKey: KVWKPVIFLYKWDP-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NOS |
|---|---|
| Molecular weight | 209.19 g/mol |
| IUPAC name | 4-(trifluoromethylsulfinyl)aniline |
| InChIKey | KVWKPVIFLYKWDP-UHFFFAOYSA-N |
| SMILES | C1=CC(=CC=C1N)S(=O)C(F)(F)F |
Computed by PubChem (NCBI)