CAS 95414-68-9 appears in our catalog under these names: Imino(phenyl)(trifluoromethyl)-l6-sulfanone, 98%, Trifluoromethylphenyl sulfoximine. Offered by: AmBeed, Biosynth. Available pack sizes: 10g, 1g, 5g, 0,5g, 50mg.
Imino-oxo-phenyl-(trifluoromethyl)-lambda6-sulfane (CAS 95414-68-9) is a chemical compound with the molecular formula C7H6F3NOS and a molecular weight of 209.19 g/mol. IUPAC name: imino-oxo-phenyl-(trifluoromethyl)-lambda6-sulfane. InChIKey: OWOIUZZQTKKJGH-UHFFFAOYSA-N.
| Molecular formula | C7H6F3NOS |
|---|---|
| Molecular weight | 209.19 g/mol |
| IUPAC name | imino-oxo-phenyl-(trifluoromethyl)-lambda6-sulfane |
| InChIKey | OWOIUZZQTKKJGH-UHFFFAOYSA-N |
| SMILES | C1=CC=C(C=C1)S(=N)(=O)C(F)(F)F |
Computed by PubChem (NCBI)