CAS 6397-70-2 is the registry number for Mirabegron Impurity 23. Offered by: Chemat Brand. Available pack sizes: on request.
3-hydroxy-1,3-diphenylbutan-1-one (CAS 6397-70-2) is a chemical compound with the molecular formula C16H16O2 and a molecular weight of 240.30 g/mol. IUPAC name: 3-hydroxy-1,3-diphenylbutan-1-one. InChIKey: UYNBPSVTHPEZPX-UHFFFAOYSA-N.
| Molecular formula | C16H16O2 |
|---|---|
| Molecular weight | 240.30 g/mol |
| IUPAC name | 3-hydroxy-1,3-diphenylbutan-1-one |
| InChIKey | UYNBPSVTHPEZPX-UHFFFAOYSA-N |
| SMILES | CC(CC(=O)C1=CC=CC=C1)(C2=CC=CC=C2)O |
Computed by PubChem (NCBI)