CAS 832-64-4 is the registry number for 4-Methylphenanthrene. Offered by: TRC. Available pack sizes: 25mg.
4-methylphenanthrene (CAS 832-64-4) is a chemical compound with the molecular formula C15H12 and a molecular weight of 192.25 g/mol. IUPAC name: 4-methylphenanthrene. InChIKey: LOCGAKKLRVLQAM-UHFFFAOYSA-N.
| Molecular formula | C15H12 |
|---|---|
| Molecular weight | 192.25 g/mol |
| IUPAC name | 4-methylphenanthrene |
| InChIKey | LOCGAKKLRVLQAM-UHFFFAOYSA-N |
| SMILES | CC1=C2C(=CC=C1)C=CC3=CC=CC=C32 |
Computed by PubChem (NCBI)