Products 6407-19-8

CAS 6407-19-8 is the registry number for Mirtazapine Impurity 5 HCl. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

2-chloro-N-(2-chloroethyl)-N-methyl-2-phenylethanamine;hydrochloride (CAS 6407-19-8) is a chemical compound with the molecular formula C11H16Cl3N and a molecular weight of 268.6 g/mol. IUPAC name: 2-chloro-N-(2-chloroethyl)-N-methyl-2-phenylethanamine;hydrochloride. InChIKey: FPZZEOLIJARXPC-UHFFFAOYSA-N.

Identity
Molecular formulaC11H16Cl3N
Molecular weight268.6 g/mol
IUPAC name2-chloro-N-(2-chloroethyl)-N-methyl-2-phenylethanamine;hydrochloride
InChIKeyFPZZEOLIJARXPC-UHFFFAOYSA-N
SMILESCN(CCCl)CC(C1=CC=CC=C1)Cl.Cl

Computed by PubChem (NCBI)