Products 64113-91-3
CAS 64113-91-3 appears in our catalog under these names: tert-Butyl 2-Aminobenzoate, >95% (HPLC), tert-butyl 2-aminobenzoate, TERT-BUTYL ANTHRANILATE, tert-Butyl 2-aminobenzoate, 95%, 95%, tert-Butyl 2-aminobenzoate, 95%. Offered by: TRC, Biosynth, Sigma-Aldrich, Chemat, Fluorochem. Available pack sizes: 10mg, 50mg, 5mg, 5g, 2g, 10g, 2.5G, 100mg.
Tert-butyl 2-aminobenzoate (CAS 64113-91-3) is a chemical compound with the molecular formula C11H15NO2 and a molecular weight of 193.24 g/mol. IUPAC name: tert-butyl 2-aminobenzoate. InChIKey: HDXMPGOKFMBDHJ-UHFFFAOYSA-N.
| Molecular formula | C11H15NO2 |
|---|---|
| Molecular weight | 193.24 g/mol |
| IUPAC name | tert-butyl 2-aminobenzoate |
| InChIKey | HDXMPGOKFMBDHJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)C1=CC=CC=C1N |
Computed by PubChem (NCBI)
Synonyms:
Benzoic acid, 2-amino-, 1,1-dimethylethyl ester, tert-Butyl 2-aminobenzoate, tert-Butyl anthranilate, 2-amino benzoic acid t-butyl ester, t-butyl 2-aminobenzoate, 1,1-dimethylethyl aminobenzoate, 1,1-dimethylethyl 2-aminobenzoate, Anthranilic acid, tert.-butyl ester, 2-amino-benzoic acid tert-butyl ester, tert-Butyl 2-aminobenzoate, >=97.0%