Products 6412-96-0
CAS 6412-96-0 is the registry number for 1-(benzo[d][1,3]dioxol-5-yl)-2,2-dimethylpropan-1-ol, 95%. Offered by: Chemat. Available pack sizes: 100mg, 250mg, 1g.
1-(1,3-benzodioxol-5-yl)-2,2-dimethylpropan-1-ol (CAS 6412-96-0) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 1-(1,3-benzodioxol-5-yl)-2,2-dimethylpropan-1-ol. InChIKey: DWYCBTALKRDQJX-UHFFFAOYSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 1-(1,3-benzodioxol-5-yl)-2,2-dimethylpropan-1-ol |
| InChIKey | DWYCBTALKRDQJX-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(C1=CC2=C(C=C1)OCO2)O |
Computed by PubChem (NCBI)