CAS 64189-17-9 appears in our catalog under these names: Cinacalcet Impurity 98, 3-(3-(Trifluoromethyl)phenyl)prop-2-en-1-ol, 3–(3–(trifluoromethyl)phenyl)prop–2–en–1–ol. Offered by: Chemat Brand, TRC, GLPBio. Available pack sizes: on request, 1g, 10mg.
(E)-3-[3-(trifluoromethyl)phenyl]prop-2-en-1-ol (CAS 64189-17-9) is a chemical compound with the molecular formula C10H9F3O and a molecular weight of 202.17 g/mol. IUPAC name: (E)-3-[3-(trifluoromethyl)phenyl]prop-2-en-1-ol. InChIKey: YDNLMIBCGPTFIK-DUXPYHPUSA-N.
| Molecular formula | C10H9F3O |
|---|---|
| Molecular weight | 202.17 g/mol |
| IUPAC name | (E)-3-[3-(trifluoromethyl)phenyl]prop-2-en-1-ol |
| InChIKey | YDNLMIBCGPTFIK-DUXPYHPUSA-N |
| SMILES | C1=CC(=CC(=C1)C(F)(F)F)/C=C/CO |
Computed by PubChem (NCBI)