CAS 64223-57-0 appears in our catalog under these names: 5-Hydroxyphthalazin-1(2H)-one, 98%, 5-Hydroxy-1,2-dihydrophthalazin-1-one. Offered by: AmBeed, Biosynth. Available pack sizes: 1g, 5g, 0,5g, 50mg.
5-hydroxy-2H-phthalazin-1-one (CAS 64223-57-0) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 5-hydroxy-2H-phthalazin-1-one. InChIKey: GMMMVARINBJYFS-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 5-hydroxy-2H-phthalazin-1-one |
| InChIKey | GMMMVARINBJYFS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=NNC2=O)C(=C1)O |
Computed by PubChem (NCBI)