CAS 64223-67-2 is the registry number for 7-Hydroxy-1(2H)-phthalazinone. Offered by: TRC. Available pack sizes: 2,5g.
7-hydroxy-2H-phthalazin-1-one (CAS 64223-67-2) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 7-hydroxy-2H-phthalazin-1-one. InChIKey: VTCJYAOTQOERTI-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 7-hydroxy-2H-phthalazin-1-one |
| InChIKey | VTCJYAOTQOERTI-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1O)C(=O)NN=C2 |
Computed by PubChem (NCBI)