Products 64267-73-8
CAS 64267-73-8 appears in our catalog under these names: D-Galactose-1-d, D-Galactose-d1. Offered by: TRC, MedChemExpress. Available pack sizes: 250mg, 25mg, 50 mg, 25 mg, 100 mg.
(3R,4S,5R,6R)-2-deuterio-6-(hydroxymethyl)oxane-2,3,4,5-tetrol (CAS 64267-73-8) is a chemical compound with the molecular formula C6H12O6 and a molecular weight of 181.16 g/mol. IUPAC name: (3R,4S,5R,6R)-2-deuterio-6-(hydroxymethyl)oxane-2,3,4,5-tetrol. InChIKey: WQZGKKKJIJFFOK-RUIMULFXSA-N.
| Molecular formula | C6H12O6 |
|---|---|
| Molecular weight | 181.16 g/mol |
| IUPAC name | (3R,4S,5R,6R)-2-deuterio-6-(hydroxymethyl)oxane-2,3,4,5-tetrol |
| InChIKey | WQZGKKKJIJFFOK-RUIMULFXSA-N |
| SMILES | [2H]C1([C@@H]([C@H]([C@H]([C@H](O1)CO)O)O)O)O |
Computed by PubChem (NCBI)
Synonyms:
D-(C~1~-~2~H)Galactopyranose, D-Galactose-1-d, (3R,4S,5R,6R)-2-deuterio-6-(hydroxymethyl)oxane-2,3,4,5-tetrol, D-Galactose-d, (+)-Galactose-1-d; D-(+)-Galactose-1-d; Galactose-1-d;, D-Galactose-1-d, 98 atom % D, D-Galactose-1-d, S & P tested, 98 atom % D, (3R,4S,5R,6R)-6-(hydroxymethyl)(2-?H)oxane-2,3,4,5-tetrol