CAS 64395-76-2 is the registry number for Isoalloalantolactone - Inula helenium (elecampane). Offered by: Biosynth. Available pack sizes: 2mg, 5mg, 10mg, 25mg.
(3aR,4aR,8aR,9aR)-5,8a-dimethyl-3-methylidene-4,4a,7,8,9,9a-hexahydro-3aH-benzo[f][1]benzofuran-2-one (CAS 64395-76-2) is a chemical compound with the molecular formula C15H20O2 and a molecular weight of 232.32 g/mol. IUPAC name: (3aR,4aR,8aR,9aR)-5,8a-dimethyl-3-methylidene-4,4a,7,8,9,9a-hexahydro-3aH-benzo[f][1]benzofuran-2-one. InChIKey: PQRAHHQIYITFCT-QVHKTLOISA-N.
| Molecular formula | C15H20O2 |
|---|---|
| Molecular weight | 232.32 g/mol |
| IUPAC name | (3aR,4aR,8aR,9aR)-5,8a-dimethyl-3-methylidene-4,4a,7,8,9,9a-hexahydro-3aH-benzo[f][1]benzofuran-2-one |
| InChIKey | PQRAHHQIYITFCT-QVHKTLOISA-N |
| SMILES | CC1=CCC[C@]2([C@H]1C[C@H]3[C@@H](C2)OC(=O)C3=C)C |
Computed by PubChem (NCBI)