Products 64400-53-9
CAS 64400-53-9 is the registry number for Benzoic acid, 3-formyl-4,6-dihydroxy-2-methyl-, methyl ester, ≥98%. Offered by: Chemat. Available pack sizes: 2mg.
Methyl 3-formyl-4,6-dihydroxy-2-methylbenzoate (CAS 64400-53-9) is a chemical compound with the molecular formula C10H10O5 and a molecular weight of 210.18 g/mol. IUPAC name: methyl 3-formyl-4,6-dihydroxy-2-methylbenzoate. InChIKey: QGZOCMQCOZSUOC-UHFFFAOYSA-N.
| Molecular formula | C10H10O5 |
|---|---|
| Molecular weight | 210.18 g/mol |
| IUPAC name | methyl 3-formyl-4,6-dihydroxy-2-methylbenzoate |
| InChIKey | QGZOCMQCOZSUOC-UHFFFAOYSA-N |
| SMILES | CC1=C(C(=CC(=C1C(=O)OC)O)O)C=O |
Computed by PubChem (NCBI)