CAS 64436-59-5 appears in our catalog under these names: 2,2-Dimethyl-4'-fluoropropiophenone 95%, 2,2-Dimethyl-4'-fluoropropiophenone, 95%, 95%, 2,2-Dimethyl-4'-fluoropropiophenone, 97%. Offered by: Ambeed, Chemat, Fluorochem. Available pack sizes: 100mg, 250mg, 1g.
1-(4-fluorophenyl)-2,2-dimethylpropan-1-one (CAS 64436-59-5) is a chemical compound with the molecular formula C11H13FO and a molecular weight of 180.22 g/mol. IUPAC name: 1-(4-fluorophenyl)-2,2-dimethylpropan-1-one. InChIKey: NDBBINMFHIVBMW-UHFFFAOYSA-N.
| Molecular formula | C11H13FO |
|---|---|
| Molecular weight | 180.22 g/mol |
| IUPAC name | 1-(4-fluorophenyl)-2,2-dimethylpropan-1-one |
| InChIKey | NDBBINMFHIVBMW-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C(=O)C1=CC=C(C=C1)F |
Computed by PubChem (NCBI)