Products 64471-43-8

CAS 64471-43-8 is the registry number for Glycopyrrolate Impurity 21. Offered by: Chemat Brand. Available pack sizes: on request.

Structural formula: {0} (CAS {1})

(2S)-2-cyclopentyl-2-hydroxy-2-phenylacetic acid (CAS 64471-43-8) is a chemical compound with the molecular formula C13H16O3 and a molecular weight of 220.26 g/mol. IUPAC name: (2S)-2-cyclopentyl-2-hydroxy-2-phenylacetic acid. InChIKey: WFLUEQCOAQCQLP-CYBMUJFWSA-N.

Identity
Molecular formulaC13H16O3
Molecular weight220.26 g/mol
IUPAC name(2S)-2-cyclopentyl-2-hydroxy-2-phenylacetic acid
InChIKeyWFLUEQCOAQCQLP-CYBMUJFWSA-N
SMILESC1CCC(C1)[C@](C2=CC=CC=C2)(C(=O)O)O

Computed by PubChem (NCBI)