Products 64500-84-1
CAS 64500-84-1 is the registry number for (((4,6-dimethylpyrimidin-2-yl)amino)methylene)methane-1,1-dicarbonitrile. Offered by: Biosynth. Available pack sizes: 250mg.
2-[[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]propanedinitrile (CAS 64500-84-1) is a chemical compound with the molecular formula C10H9N5 and a molecular weight of 199.21 g/mol. IUPAC name: 2-[[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]propanedinitrile. InChIKey: ZWPSAKJPSLYTHZ-UHFFFAOYSA-N.
| Molecular formula | C10H9N5 |
|---|---|
| Molecular weight | 199.21 g/mol |
| IUPAC name | 2-[[(4,6-dimethylpyrimidin-2-yl)amino]methylidene]propanedinitrile |
| InChIKey | ZWPSAKJPSLYTHZ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=NC(=N1)NC=C(C#N)C#N)C |
Computed by PubChem (NCBI)