CAS 64590-80-3 is the registry number for (E)-2-Acetamido-3-phenylacrylic acid. Offered by: Biosynth. Available pack sizes: 25g.
(E)-2-acetamido-3-phenylprop-2-enoic acid (CAS 64590-80-3) is a chemical compound with the molecular formula C11H11NO3 and a molecular weight of 205.21 g/mol. IUPAC name: (E)-2-acetamido-3-phenylprop-2-enoic acid. InChIKey: XODAOBAZOQSFDS-JXMROGBWSA-N.
| Molecular formula | C11H11NO3 |
|---|---|
| Molecular weight | 205.21 g/mol |
| IUPAC name | (E)-2-acetamido-3-phenylprop-2-enoic acid |
| InChIKey | XODAOBAZOQSFDS-JXMROGBWSA-N |
| SMILES | CC(=O)N/C(=C/C1=CC=CC=C1)/C(=O)O |
Computed by PubChem (NCBI)