Products 646039-32-9
CAS 646039-32-9 is the registry number for 4-(3-Bromo-4-methoxyphenyl)butan-2-one, 97%. Offered by: Fluorochem, Chemat. Available pack sizes: 100mg, 250mg, 1g, 5g, 10g.
4-(3-bromo-4-methoxyphenyl)butan-2-one (CAS 646039-32-9) is a chemical compound with the molecular formula C11H13BrO2 and a molecular weight of 257.12 g/mol. IUPAC name: 4-(3-bromo-4-methoxyphenyl)butan-2-one. InChIKey: FNTAMXRWDOFLIO-UHFFFAOYSA-N.
| Molecular formula | C11H13BrO2 |
|---|---|
| Molecular weight | 257.12 g/mol |
| IUPAC name | 4-(3-bromo-4-methoxyphenyl)butan-2-one |
| InChIKey | FNTAMXRWDOFLIO-UHFFFAOYSA-N |
| SMILES | CC(=O)CCC1=CC(=C(C=C1)OC)Br |
Computed by PubChem (NCBI)