CAS 64630-00-8 appears in our catalog under these names: 2-amino-4-cyanobenzoic acid, >95% (HPLC), 2-amino-4-cyanobenzoic acid, 2-Amino-4-cyanobenzoic acid, 97%, 97%, 2-AMINO-4-CYANOBENZOIC ACID, 95%. Offered by: TRC, Biosynth, Chemat, Fluorochem. Available pack sizes: 100mg, 500mg, 50mg, 5g, 0,5g, 10g, 250mg, 1g.
2-amino-4-cyanobenzoic acid (CAS 64630-00-8) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 2-amino-4-cyanobenzoic acid. InChIKey: LTYSISNGLCCCBW-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 2-amino-4-cyanobenzoic acid |
| InChIKey | LTYSISNGLCCCBW-UHFFFAOYSA-N |
| SMILES | C1=CC(=C(C=C1C#N)N)C(=O)O |
Computed by PubChem (NCBI)