CAS 64715-86-2 appears in our catalog under these names: (R)–2–Methoxy–1–phenylethanamine hydrochloride, (1R)-2-Methoxy-1-phenylethanamine, hydrochloride. Offered by: GLPBio, Biosynth. Available pack sizes: 100mg, 1g, 250mg, 2,5g.
(1R)-2-methoxy-1-phenylethanamine;hydrochloride (CAS 64715-86-2) is a chemical compound with the molecular formula C9H14ClNO and a molecular weight of 187.66 g/mol. IUPAC name: (1R)-2-methoxy-1-phenylethanamine;hydrochloride. InChIKey: DLMKXYXAHHMDJR-FVGYRXGTSA-N.
| Molecular formula | C9H14ClNO |
|---|---|
| Molecular weight | 187.66 g/mol |
| IUPAC name | (1R)-2-methoxy-1-phenylethanamine;hydrochloride |
| InChIKey | DLMKXYXAHHMDJR-FVGYRXGTSA-N |
| SMILES | COC[C@@H](C1=CC=CC=C1)N.Cl |
Computed by PubChem (NCBI)