Products 64744-41-8
CAS 64744-41-8 is the registry number for 3-Hydroxy-3-azaspiro[5.5]undecane-2,4-dione, 98%. Offered by: Ambeed, BLDpharm. Available pack sizes: 100mg, 250mg, 1g, 5g.
3-hydroxy-3-azaspiro[5.5]undecane-2,4-dione (CAS 64744-41-8) is a chemical compound with the molecular formula C10H15NO3 and a molecular weight of 197.23 g/mol. IUPAC name: 3-hydroxy-3-azaspiro[5.5]undecane-2,4-dione. InChIKey: ZBAUSHIGYKKATD-UHFFFAOYSA-N.
| Molecular formula | C10H15NO3 |
|---|---|
| Molecular weight | 197.23 g/mol |
| IUPAC name | 3-hydroxy-3-azaspiro[5.5]undecane-2,4-dione |
| InChIKey | ZBAUSHIGYKKATD-UHFFFAOYSA-N |
| SMILES | C1CCC2(CC1)CC(=O)N(C(=O)C2)O |
Computed by PubChem (NCBI)