CAS 648449-67-6 is the registry number for 3-Amino-1,2-benzoxazole-5-carbaldehyde. Offered by: Biosynth. Available pack sizes: 0,5g, 50mg.
3-amino-1,2-benzoxazole-5-carbaldehyde (CAS 648449-67-6) is a chemical compound with the molecular formula C8H6N2O2 and a molecular weight of 162.15 g/mol. IUPAC name: 3-amino-1,2-benzoxazole-5-carbaldehyde. InChIKey: UQYYIXGRQZJGBS-UHFFFAOYSA-N.
| Molecular formula | C8H6N2O2 |
|---|---|
| Molecular weight | 162.15 g/mol |
| IUPAC name | 3-amino-1,2-benzoxazole-5-carbaldehyde |
| InChIKey | UQYYIXGRQZJGBS-UHFFFAOYSA-N |
| SMILES | C1=CC2=C(C=C1C=O)C(=NO2)N |
Computed by PubChem (NCBI)