CAS 64874-38-0 appears in our catalog under these names: 6–Bromo–1,8–naphthyridin–2–amine, 6-Bromo-1,8-naphthyridin-2-amine, 98%, 98%, 2-Amino-6-bromo-1,8-naphthyridine, 97%, 6-Bromo-1,8-naphthyridin-2-amine, 98%. Offered by: GLPBio, Chemat, Fluorochem, Ambeed. Available pack sizes: 100mg, 1g, 250mg, 5g, 10g, 25g.
6-bromo-1,8-naphthyridin-2-amine (CAS 64874-38-0) is a chemical compound with the molecular formula C8H6BrN3 and a molecular weight of 224.06 g/mol. IUPAC name: 6-bromo-1,8-naphthyridin-2-amine. InChIKey: PEDHUXRIIJIMDP-UHFFFAOYSA-N.
| Molecular formula | C8H6BrN3 |
|---|---|
| Molecular weight | 224.06 g/mol |
| IUPAC name | 6-bromo-1,8-naphthyridin-2-amine |
| InChIKey | PEDHUXRIIJIMDP-UHFFFAOYSA-N |
| SMILES | C1=CC(=NC2=NC=C(C=C21)Br)N |
Computed by PubChem (NCBI)