CAS 648930-78-3 appears in our catalog under these names: Fmoc-cis-3-Hydroxy-L-proline, 98%, 98%, (2S,3R)-1-(((9H-Fluoren-9-yl)methoxy)carbonyl)-3-hydroxypyrrolidine-2-carboxylic acid, 98%. Offered by: Chemat, AmBeed. Available pack sizes: 1g, 100mg, 250mg.
(2S,3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-3-hydroxypyrrolidine-2-carboxylic acid (CAS 648930-78-3) is a chemical compound with the molecular formula C20H19NO5 and a molecular weight of 353.4 g/mol. IUPAC name: (2S,3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-3-hydroxypyrrolidine-2-carboxylic acid. InChIKey: NQSYYVTUCHIRTM-MSOLQXFVSA-N.
| Molecular formula | C20H19NO5 |
|---|---|
| Molecular weight | 353.4 g/mol |
| IUPAC name | (2S,3R)-1-(9H-fluoren-9-ylmethoxycarbonyl)-3-hydroxypyrrolidine-2-carboxylic acid |
| InChIKey | NQSYYVTUCHIRTM-MSOLQXFVSA-N |
| SMILES | C1CN([C@@H]([C@@H]1O)C(=O)O)C(=O)OCC2C3=CC=CC=C3C4=CC=CC=C24 |
Computed by PubChem (NCBI)