CAS 650597-66-3 is the registry number for Methyl 2,3-dihydro-1,4-benzodioxin-2-carboxylic Acid. Offered by: TRC. Available pack sizes: 500mg.
Methyl (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylate (CAS 650597-66-3) is a chemical compound with the molecular formula C10H10O4 and a molecular weight of 194.18 g/mol. IUPAC name: methyl (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylate. InChIKey: SNLAAGHHNZECPE-VIFPVBQESA-N.
| Molecular formula | C10H10O4 |
|---|---|
| Molecular weight | 194.18 g/mol |
| IUPAC name | methyl (3S)-2,3-dihydro-1,4-benzodioxine-3-carboxylate |
| InChIKey | SNLAAGHHNZECPE-VIFPVBQESA-N |
| SMILES | COC(=O)[C@@H]1COC2=CC=CC=C2O1 |
Computed by PubChem (NCBI)