CAS 65078-05-9 appears in our catalog under these names: 4-methyl-2-nitrobenzamide, 96%, 4-Methyl-2-nitrobenzamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 1g.
4-methyl-2-nitrobenzamide (CAS 65078-05-9) is a chemical compound with the molecular formula C8H8N2O3 and a molecular weight of 180.16 g/mol. IUPAC name: 4-methyl-2-nitrobenzamide. InChIKey: VWKSRDFIGWFBMV-UHFFFAOYSA-N.
| Molecular formula | C8H8N2O3 |
|---|---|
| Molecular weight | 180.16 g/mol |
| IUPAC name | 4-methyl-2-nitrobenzamide |
| InChIKey | VWKSRDFIGWFBMV-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C=C1)C(=O)N)[N+](=O)[O-] |
Computed by PubChem (NCBI)