CAS 6512-32-9 appears in our catalog under these names: 3,5-Dimethoxyphenylacetic acid methyl ester, 98%, 3,5-Dimethoxyphenylacetic Acid Methyl Ester, Methyl (3,5–Dimethoxyphenyl)acetate, Methyl (3,5-Dimethoxyphenyl)acetate, >98.0%(GC), 3,5-Dimethoxyphenylacetic acid methyl es, ter, 5 g. Offered by: Combi-blocks, TRC, GLPBio, TCI, Biosynth. Available pack sizes: 1g, 5g, 100mg, 10mg, 50mg, 250mg, 25g, 10g.
Methyl 2-(3,5-dimethoxyphenyl)acetate (CAS 6512-32-9) is a chemical compound with the molecular formula C11H14O4 and a molecular weight of 210.23 g/mol. IUPAC name: methyl 2-(3,5-dimethoxyphenyl)acetate. InChIKey: CLZWNNSTRIEAMH-UHFFFAOYSA-N.
| Molecular formula | C11H14O4 |
|---|---|
| Molecular weight | 210.23 g/mol |
| IUPAC name | methyl 2-(3,5-dimethoxyphenyl)acetate |
| InChIKey | CLZWNNSTRIEAMH-UHFFFAOYSA-N |
| SMILES | COC1=CC(=CC(=C1)CC(=O)OC)OC |
Computed by PubChem (NCBI)