Products 65136-52-9

CAS 65136-52-9 is the registry number for 4-Chloro-3-propoxybenzoic acid, 98%. Offered by: Combi-blocks. Available pack sizes: 1g, 100g, 25g, 5g.

Structural formula: {0} (CAS {1})

4-chloro-3-propoxybenzoic acid (CAS 65136-52-9) is a chemical compound with the molecular formula C10H11ClO3 and a molecular weight of 214.64 g/mol. IUPAC name: 4-chloro-3-propoxybenzoic acid. InChIKey: GSTOIQLTEUFNGQ-UHFFFAOYSA-N.

Identity
Molecular formulaC10H11ClO3
Molecular weight214.64 g/mol
IUPAC name4-chloro-3-propoxybenzoic acid
InChIKeyGSTOIQLTEUFNGQ-UHFFFAOYSA-N
SMILESCCCOC1=C(C=CC(=C1)C(=O)O)Cl

Computed by PubChem (NCBI)