CAS 65151-58-8 appears in our catalog under these names: 3,4-Dimethyl-5-nitrophenol, 95%, 3,4-Dimethyl-5-nitrophenol, 98%, 98%, 3,4-Dimethyl-5-nitrophenol, 98%. Offered by: Combi-blocks, Chemat, Fluorochem. Available pack sizes: 250mg, 1g, 100mg.
3,4-dimethyl-5-nitrophenol (CAS 65151-58-8) is a chemical compound with the molecular formula C8H9NO3 and a molecular weight of 167.16 g/mol. IUPAC name: 3,4-dimethyl-5-nitrophenol. InChIKey: HKQSKINMCHAPPJ-UHFFFAOYSA-N.
| Molecular formula | C8H9NO3 |
|---|---|
| Molecular weight | 167.16 g/mol |
| IUPAC name | 3,4-dimethyl-5-nitrophenol |
| InChIKey | HKQSKINMCHAPPJ-UHFFFAOYSA-N |
| SMILES | CC1=CC(=CC(=C1C)[N+](=O)[O-])O |
Computed by PubChem (NCBI)