Products 6521-30-8
CAS 6521-30-8 appears in our catalog under these names: 4-Hydroxybenzoic acid isoamyl ester, 95%, Isoamyl 4-Hydroxybenzoate, >98.0%(GC)(T), Isopentyl 4-hydroxybenzoate, 98%. Offered by: Combi-blocks, TCI, Fluorochem, Chemat. Available pack sizes: 1g, 25g, 5g, 10g.
3-methylbutyl 4-hydroxybenzoate (CAS 6521-30-8) is a chemical compound with the molecular formula C12H16O3 and a molecular weight of 208.25 g/mol. IUPAC name: 3-methylbutyl 4-hydroxybenzoate. InChIKey: KSHVDKDQYBNSAN-UHFFFAOYSA-N.
| Molecular formula | C12H16O3 |
|---|---|
| Molecular weight | 208.25 g/mol |
| IUPAC name | 3-methylbutyl 4-hydroxybenzoate |
| InChIKey | KSHVDKDQYBNSAN-UHFFFAOYSA-N |
| SMILES | CC(C)CCOC(=O)C1=CC=C(C=C1)O |
Computed by PubChem (NCBI)
Synonyms:
Isopentyl 4-hydroxybenzoate, Isoamyl 4-Hydroxybenzoate, 4-Hydroxybenzoic Acid Isoamyl Ester, Isoamyl p-hydroxybenzoate, Benzoic acid, 4-hydroxy-, 3-methylbutyl ester, p-Hydroxybenzoic acid isoamyl ester, Benzoic acid, p-hydroxy-, isopentyl ester, ISOPENTYL P-HYDROXYBENZOATE, ISOPENTYL ALCOHOL, P-HYDROXYBENZOATE, 3-methylbutyl 4-hydroxybenzoate