CAS 65234-07-3 is the registry number for 3-(4-Ethoxyphenyl)-2-mercapto-5,6-dimethylthieno[2,3-d]pyrimidin-4(3H)-one, 98%. Offered by: Chemat Brand. Available pack sizes: on request.
3-(4-ethoxyphenyl)-5,6-dimethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one (CAS 65234-07-3) is a chemical compound with the molecular formula C16H16N2O2S2 and a molecular weight of 332.4 g/mol. IUPAC name: 3-(4-ethoxyphenyl)-5,6-dimethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one. InChIKey: RFJZJRXUFVFJIS-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O2S2 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 3-(4-ethoxyphenyl)-5,6-dimethyl-2-sulfanylidene-1H-thieno[2,3-d]pyrimidin-4-one |
| InChIKey | RFJZJRXUFVFJIS-UHFFFAOYSA-N |
| SMILES | CCOC1=CC=C(C=C1)N2C(=O)C3=C(NC2=S)SC(=C3C)C |
Computed by PubChem (NCBI)