Products 92966-73-9
CAS 92966-73-9 is the registry number for N,4-Dimethyl-N-(2-methylbenzo[d]thiazol-5-yl)benzenesulfonamide, 98%, 98%. Offered by: Chemat. Available pack sizes: 5mg, 10mg, 25mg, 50mg.
N,4-dimethyl-N-(2-methyl-1,3-benzothiazol-5-yl)benzenesulfonamide (CAS 92966-73-9) is a chemical compound with the molecular formula C16H16N2O2S2 and a molecular weight of 332.4 g/mol. IUPAC name: N,4-dimethyl-N-(2-methyl-1,3-benzothiazol-5-yl)benzenesulfonamide. InChIKey: HPZSZQVTMGNBSD-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O2S2 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | N,4-dimethyl-N-(2-methyl-1,3-benzothiazol-5-yl)benzenesulfonamide |
| InChIKey | HPZSZQVTMGNBSD-UHFFFAOYSA-N |
| SMILES | CC1=CC=C(C=C1)S(=O)(=O)N(C)C2=CC3=C(C=C2)SC(=N3)C |
Computed by PubChem (NCBI)