Products 956576-64-0
CAS 956576-64-0 is the registry number for 4-Isothiocyanato-n-mesitylbenzenesulfonamide, 95%. Offered by: Combi-blocks, AmBeed. Available pack sizes: 5g, 250mg, 1g.
4-isothiocyanato-N-(2,4,6-trimethylphenyl)benzenesulfonamide (CAS 956576-64-0) is a chemical compound with the molecular formula C16H16N2O2S2 and a molecular weight of 332.4 g/mol. IUPAC name: 4-isothiocyanato-N-(2,4,6-trimethylphenyl)benzenesulfonamide. InChIKey: BQFIPAQABNGLTI-UHFFFAOYSA-N.
| Molecular formula | C16H16N2O2S2 |
|---|---|
| Molecular weight | 332.4 g/mol |
| IUPAC name | 4-isothiocyanato-N-(2,4,6-trimethylphenyl)benzenesulfonamide |
| InChIKey | BQFIPAQABNGLTI-UHFFFAOYSA-N |
| SMILES | CC1=CC(=C(C(=C1)C)NS(=O)(=O)C2=CC=C(C=C2)N=C=S)C |
Computed by PubChem (NCBI)