CAS 65364-63-8 appears in our catalog under these names: Cyanopyrimidin-2-yl-acetic acid ethyl ester, 95%, Ethyl 2-cyano-2-(pyrimidin-2-yl)acetate, 95%, Cyanopyrimidin-2-yl-acetic acid ethyl ester, >97%, >97%, Cyanopyrimidin-2-yl-acetic acid ethyl ester. Offered by: Combi-blocks, AmBeed, Chemat, Fluorochem. Available pack sizes: 5g, 1g, 250mg, 100mg.
Ethyl 2-cyano-2-pyrimidin-2-ylacetate (CAS 65364-63-8) is a chemical compound with the molecular formula C9H9N3O2 and a molecular weight of 191.19 g/mol. IUPAC name: ethyl 2-cyano-2-pyrimidin-2-ylacetate. InChIKey: CGJJSVUMDOTFHU-UHFFFAOYSA-N.
| Molecular formula | C9H9N3O2 |
|---|---|
| Molecular weight | 191.19 g/mol |
| IUPAC name | ethyl 2-cyano-2-pyrimidin-2-ylacetate |
| InChIKey | CGJJSVUMDOTFHU-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(C#N)C1=NC=CC=N1 |
Computed by PubChem (NCBI)